C11H15BrO3 — CID 103451748
1-[(3-bromofuran-2-yl)-hydroxymethyl]cyclohexan-1-ol (PubChem CID 103451748) has the molecular formula C11H15BrO3 and a molecular weight of 275.14 g/mol. Its IUPAC name is 1-[(3-bromofuran-2-yl)-hydroxymethyl]cyclohexan-1-ol.
| Compound Name | 1-[(3-bromofuran-2-yl)-hydroxymethyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 103451748 |
| Molecular Formula | C11H15BrO3 |
| Molecular Weight | 275.14 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 1-[(3-bromofuran-2-yl)-hydroxymethyl]cyclohexan-1-ol |
| SMILES | OC(c1occc1Br)C1(O)CCCCC1 |
| InChI | InChI=1S/C11H15BrO3/c12-8-4-7-15-9(8)10(13)11(14)5-2-1-3-6-11/h4,7,10,13-14H,1-3,5-6H2 |
| InChIKey | RPZPGWHXTUBRQV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.14 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |