C10H13BrO2S — CID 130506442
(3-bromofuran-2-yl)-(1-methylsulfanylcyclobutyl)methanol (PubChem CID 130506442) has the molecular formula C10H13BrO2S and a molecular weight of 277.18 g/mol. Its IUPAC name is (3-bromofuran-2-yl)-(1-methylsulfanylcyclobutyl)methanol.
| Compound Name | (3-bromofuran-2-yl)-(1-methylsulfanylcyclobutyl)methanol |
|---|---|
| PubChem CID | 130506442 |
| Molecular Formula | C10H13BrO2S |
| Molecular Weight | 277.18 g/mol |
| Exact Mass | 275.98 |
| IUPAC Name | (3-bromofuran-2-yl)-(1-methylsulfanylcyclobutyl)methanol |
| SMILES | CSC1(C(O)c2occc2Br)CCC1 |
| InChI | InChI=1S/C10H13BrO2S/c1-14-10(4-2-5-10)9(12)8-7(11)3-6-13-8/h3,6,9,12H,2,4-5H2,1H3 |
| InChIKey | GMKMVESNDSUQGF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.18 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |