C11H16BrNO2 — CID 115927959
[1-[1-(3-bromofuran-2-yl)ethylamino]cyclobutyl]methanol (PubChem CID 115927959) has the molecular formula C11H16BrNO2 and a molecular weight of 274.16 g/mol. Its IUPAC name is [1-[1-(3-bromofuran-2-yl)ethylamino]cyclobutyl]methanol.
| Compound Name | [1-[1-(3-bromofuran-2-yl)ethylamino]cyclobutyl]methanol |
|---|---|
| PubChem CID | 115927959 |
| Molecular Formula | C11H16BrNO2 |
| Molecular Weight | 274.16 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | [1-[1-(3-bromofuran-2-yl)ethylamino]cyclobutyl]methanol |
| SMILES | CC(NC1(CO)CCC1)c1occc1Br |
| InChI | InChI=1S/C11H16BrNO2/c1-8(10-9(12)3-6-15-10)13-11(7-14)4-2-5-11/h3,6,8,13-14H,2,4-5,7H2,1H3 |
| InChIKey | PWPDMPLRHMJQMQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.16 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |