C12H18BrNO2 — CID 115727604
1-(3-bromofuran-2-yl)-N-[(2-methyloxolan-2-yl)methyl]ethanamine (PubChem CID 115727604) has the molecular formula C12H18BrNO2 and a molecular weight of 288.18 g/mol. Its IUPAC name is 1-(3-bromofuran-2-yl)-N-[(2-methyloxolan-2-yl)methyl]ethanamine.
| Compound Name | 1-(3-bromofuran-2-yl)-N-[(2-methyloxolan-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 115727604 |
| Molecular Formula | C12H18BrNO2 |
| Molecular Weight | 288.18 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 1-(3-bromofuran-2-yl)-N-[(2-methyloxolan-2-yl)methyl]ethanamine |
| SMILES | CC(NCC1(C)CCCO1)c1occc1Br |
| InChI | InChI=1S/C12H18BrNO2/c1-9(11-10(13)4-7-15-11)14-8-12(2)5-3-6-16-12/h4,7,9,14H,3,5-6,8H2,1-2H3 |
| InChIKey | BAKHIJNGCXBIJB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.18 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |