C13H18BrNO — CID 115976164
[1-[1-(4-bromo-3-methylphenyl)ethylamino]cyclopropyl]methanol (PubChem CID 115976164) has the molecular formula C13H18BrNO and a molecular weight of 284.20 g/mol. Its IUPAC name is [1-[1-(4-bromo-3-methylphenyl)ethylamino]cyclopropyl]methanol.
| Compound Name | [1-[1-(4-bromo-3-methylphenyl)ethylamino]cyclopropyl]methanol |
|---|---|
| PubChem CID | 115976164 |
| Molecular Formula | C13H18BrNO |
| Molecular Weight | 284.20 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | [1-[1-(4-bromo-3-methylphenyl)ethylamino]cyclopropyl]methanol |
| SMILES | Cc1cc(C(C)NC2(CO)CC2)ccc1Br |
| InChI | InChI=1S/C13H18BrNO/c1-9-7-11(3-4-12(9)14)10(2)15-13(8-16)5-6-13/h3-4,7,10,15-16H,5-6,8H2,1-2H3 |
| InChIKey | LPMXPOSNYFQVEK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.20 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |