C12H17BrO3 — CID 103452084
1-[(3-bromofuran-2-yl)-hydroxymethyl]cycloheptan-1-ol (PubChem CID 103452084) has the molecular formula C12H17BrO3 and a molecular weight of 289.17 g/mol. Its IUPAC name is 1-[(3-bromofuran-2-yl)-hydroxymethyl]cycloheptan-1-ol.
| Compound Name | 1-[(3-bromofuran-2-yl)-hydroxymethyl]cycloheptan-1-ol |
|---|---|
| PubChem CID | 103452084 |
| Molecular Formula | C12H17BrO3 |
| Molecular Weight | 289.17 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 1-[(3-bromofuran-2-yl)-hydroxymethyl]cycloheptan-1-ol |
| SMILES | OC(c1occc1Br)C1(O)CCCCCC1 |
| InChI | InChI=1S/C12H17BrO3/c13-9-5-8-16-10(9)11(14)12(15)6-3-1-2-4-7-12/h5,8,11,14-15H,1-4,6-7H2 |
| InChIKey | BZFRLQCPWPWYJV-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.17 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |