C11H16BrNO — CID 115861247
(3-bromofuran-2-yl)-(1-methylcyclopentyl)methanamine (PubChem CID 115861247) has the molecular formula C11H16BrNO and a molecular weight of 258.16 g/mol. Its IUPAC name is (3-bromofuran-2-yl)-(1-methylcyclopentyl)methanamine.
| Compound Name | (3-bromofuran-2-yl)-(1-methylcyclopentyl)methanamine |
|---|---|
| PubChem CID | 115861247 |
| Molecular Formula | C11H16BrNO |
| Molecular Weight | 258.16 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | (3-bromofuran-2-yl)-(1-methylcyclopentyl)methanamine |
| SMILES | CC1(C(N)c2occc2Br)CCCC1 |
| InChI | InChI=1S/C11H16BrNO/c1-11(5-2-3-6-11)10(13)9-8(12)4-7-14-9/h4,7,10H,2-3,5-6,13H2,1H3 |
| InChIKey | CIMJUHHUZNXATL-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.16 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |