C12H18O3S — CID 116753823
(4-methoxyoxan-4-yl)-(3-methylthiophen-2-yl)methanol (PubChem CID 116753823) has the molecular formula C12H18O3S and a molecular weight of 242.34 g/mol. Its IUPAC name is (4-methoxyoxan-4-yl)-(3-methylthiophen-2-yl)methanol.
| Compound Name | (4-methoxyoxan-4-yl)-(3-methylthiophen-2-yl)methanol |
|---|---|
| PubChem CID | 116753823 |
| Molecular Formula | C12H18O3S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | (4-methoxyoxan-4-yl)-(3-methylthiophen-2-yl)methanol |
| SMILES | COC1(C(O)c2sccc2C)CCOCC1 |
| InChI | InChI=1S/C12H18O3S/c1-9-3-8-16-10(9)11(13)12(14-2)4-6-15-7-5-12/h3,8,11,13H,4-7H2,1-2H3 |
| InChIKey | HPMHMUYXPXTTGE-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |