C12H17BrOS — CID 103558133
2-[2-bromo-3-(1-methoxycyclobutyl)propyl]thiophene (PubChem CID 103558133) has the molecular formula C12H17BrOS and a molecular weight of 289.24 g/mol. Its IUPAC name is 2-[2-bromo-3-(1-methoxycyclobutyl)propyl]thiophene.
| Compound Name | 2-[2-bromo-3-(1-methoxycyclobutyl)propyl]thiophene |
|---|---|
| PubChem CID | 103558133 |
| Molecular Formula | C12H17BrOS |
| Molecular Weight | 289.24 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | 2-[2-bromo-3-(1-methoxycyclobutyl)propyl]thiophene |
| SMILES | COC1(CC(Br)Cc2cccs2)CCC1 |
| InChI | InChI=1S/C12H17BrOS/c1-14-12(5-3-6-12)9-10(13)8-11-4-2-7-15-11/h2,4,7,10H,3,5-6,8-9H2,1H3 |
| InChIKey | XIZSCHSMUBUTPX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.24 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|