C11H16FNO — CID 116914588
1-(5-fluoro-2-methoxyphenyl)-N,N-dimethylethanamine (PubChem CID 116914588) has the molecular formula C11H16FNO and a molecular weight of 197.25 g/mol. Its IUPAC name is 1-(5-fluoro-2-methoxyphenyl)-N,N-dimethylethanamine.
| Compound Name | 1-(5-fluoro-2-methoxyphenyl)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 116914588 |
| Molecular Formula | C11H16FNO |
| Molecular Weight | 197.25 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 1-(5-fluoro-2-methoxyphenyl)-N,N-dimethylethanamine |
| SMILES | COc1ccc(F)cc1C(C)N(C)C |
| InChI | InChI=1S/C11H16FNO/c1-8(13(2)3)10-7-9(12)5-6-11(10)14-4/h5-8H,1-4H3 |
| InChIKey | YQNBNHBDEULQCA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.25 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |