C9H12ClFN2O — CID 66517708
1-(4-chloro-2-fluoro-5-methoxyphenyl)ethane-1,2-diamine (PubChem CID 66517708) has the molecular formula C9H12ClFN2O and a molecular weight of 218.66 g/mol. Its IUPAC name is 1-(4-chloro-2-fluoro-5-methoxyphenyl)ethane-1,2-diamine.
| Compound Name | 1-(4-chloro-2-fluoro-5-methoxyphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 66517708 |
| Molecular Formula | C9H12ClFN2O |
| Molecular Weight | 218.66 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 1-(4-chloro-2-fluoro-5-methoxyphenyl)ethane-1,2-diamine |
| SMILES | COc1cc(C(N)CN)c(F)cc1Cl |
| InChI | InChI=1S/C9H12ClFN2O/c1-14-9-2-5(8(13)4-12)7(11)3-6(9)10/h2-3,8H,4,12-13H2,1H3 |
| InChIKey | XNCPNVIEFLGZFZ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.66 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |