C9H13FN2O2 — CID 77131047
4-(1,2-diaminoethyl)-5-fluoro-2-methoxyphenol (PubChem CID 77131047) has the molecular formula C9H13FN2O2 and a molecular weight of 200.21 g/mol. Its IUPAC name is 4-(1,2-diaminoethyl)-5-fluoro-2-methoxyphenol.
| Compound Name | 4-(1,2-diaminoethyl)-5-fluoro-2-methoxyphenol |
|---|---|
| PubChem CID | 77131047 |
| Molecular Formula | C9H13FN2O2 |
| Molecular Weight | 200.21 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 4-(1,2-diaminoethyl)-5-fluoro-2-methoxyphenol |
| SMILES | COc1cc(C(N)CN)c(F)cc1O |
| InChI | InChI=1S/C9H13FN2O2/c1-14-9-2-5(7(12)4-11)6(10)3-8(9)13/h2-3,7,13H,4,11-12H2,1H3 |
| InChIKey | MNFYRBCIQXDHFY-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.21 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |