C12H18ClNO4 — CID 83943166
2-amino-1-(4-chloro-2,5-dimethoxyphenyl)butane-1,4-diol (PubChem CID 83943166) has the molecular formula C12H18ClNO4 and a molecular weight of 275.73 g/mol. Its IUPAC name is 2-amino-1-(4-chloro-2,5-dimethoxyphenyl)butane-1,4-diol.
| Compound Name | 2-amino-1-(4-chloro-2,5-dimethoxyphenyl)butane-1,4-diol |
|---|---|
| PubChem CID | 83943166 |
| Molecular Formula | C12H18ClNO4 |
| Molecular Weight | 275.73 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 2-amino-1-(4-chloro-2,5-dimethoxyphenyl)butane-1,4-diol |
| SMILES | COc1cc(C(O)C(N)CCO)c(OC)cc1Cl |
| InChI | InChI=1S/C12H18ClNO4/c1-17-10-6-8(13)11(18-2)5-7(10)12(16)9(14)3-4-15/h5-6,9,12,15-16H,3-4,14H2,1-2H3 |
| InChIKey | KRIHPLQWNARKQR-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.73 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |