C15H22ClNO4 — CID 60860837
ethyl 5-amino-5-(2-chloro-4,5-dimethoxyphenyl)pentanoate (PubChem CID 60860837) has the molecular formula C15H22ClNO4 and a molecular weight of 315.80 g/mol. Its IUPAC name is ethyl 5-amino-5-(2-chloro-4,5-dimethoxyphenyl)pentanoate.
| Compound Name | ethyl 5-amino-5-(2-chloro-4,5-dimethoxyphenyl)pentanoate |
|---|---|
| PubChem CID | 60860837 |
| Molecular Formula | C15H22ClNO4 |
| Molecular Weight | 315.80 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | ethyl 5-amino-5-(2-chloro-4,5-dimethoxyphenyl)pentanoate |
| SMILES | CCOC(=O)CCCC(N)c1cc(OC)c(OC)cc1Cl |
| InChI | InChI=1S/C15H22ClNO4/c1-4-21-15(18)7-5-6-12(17)10-8-13(19-2)14(20-3)9-11(10)16/h8-9,12H,4-7,17H2,1-3H3 |
| InChIKey | RGXFDLHEWCUJES-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.80 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |