C13H20ClNO2 — CID 83943624
4-(2-chloro-4,5-dimethoxyphenyl)pentan-1-amine (PubChem CID 83943624) has the molecular formula C13H20ClNO2 and a molecular weight of 257.76 g/mol. Its IUPAC name is 4-(2-chloro-4,5-dimethoxyphenyl)pentan-1-amine.
| Compound Name | 4-(2-chloro-4,5-dimethoxyphenyl)pentan-1-amine |
|---|---|
| PubChem CID | 83943624 |
| Molecular Formula | C13H20ClNO2 |
| Molecular Weight | 257.76 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 4-(2-chloro-4,5-dimethoxyphenyl)pentan-1-amine |
| SMILES | COc1cc(Cl)c(C(C)CCCN)cc1OC |
| InChI | InChI=1S/C13H20ClNO2/c1-9(5-4-6-15)10-7-12(16-2)13(17-3)8-11(10)14/h7-9H,4-6,15H2,1-3H3 |
| InChIKey | JQEFUNPUXLDONJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.76 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |