C11H16ClNO2 — CID 43486339
1-(2-chloro-4,5-dimethoxyphenyl)-N-methylethanamine (PubChem CID 43486339) has the molecular formula C11H16ClNO2 and a molecular weight of 229.71 g/mol. Its IUPAC name is 1-(2-chloro-4,5-dimethoxyphenyl)-N-methylethanamine.
| Compound Name | 1-(2-chloro-4,5-dimethoxyphenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 43486339 |
| Molecular Formula | C11H16ClNO2 |
| Molecular Weight | 229.71 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 1-(2-chloro-4,5-dimethoxyphenyl)-N-methylethanamine |
| SMILES | CNC(C)c1cc(OC)c(OC)cc1Cl |
| InChI | InChI=1S/C11H16ClNO2/c1-7(13-2)8-5-10(14-3)11(15-4)6-9(8)12/h5-7,13H,1-4H3 |
| InChIKey | HYPZNSOSJRKMNS-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.71 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |