C12H17NO5 — CID 66515274
methyl 2-[(1S)-1-amino-2-hydroxyethyl]-4,5-dimethoxybenzoate (PubChem CID 66515274) has the molecular formula C12H17NO5 and a molecular weight of 255.27 g/mol. Its IUPAC name is methyl 2-[(1S)-1-amino-2-hydroxyethyl]-4,5-dimethoxybenzoate.
| Compound Name | methyl 2-[(1S)-1-amino-2-hydroxyethyl]-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 66515274 |
| Molecular Formula | C12H17NO5 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | methyl 2-[(1S)-1-amino-2-hydroxyethyl]-4,5-dimethoxybenzoate |
| SMILES | COC(=O)c1cc(OC)c(OC)cc1[C@H](N)CO |
| InChI | InChI=1S/C12H17NO5/c1-16-10-4-7(9(13)6-14)8(12(15)18-3)5-11(10)17-2/h4-5,9,14H,6,13H2,1-3H3/t9-/m1/s1 |
| InChIKey | DNUMKWDJRJEQGX-SECBINFHSA-N |
| XLogP | 0.48 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |