C12H14O7 — CID 130260315
methyl 2-(2-hydroxyacetyl)oxy-4,5-dimethoxybenzoate (PubChem CID 130260315) has the molecular formula C12H14O7 and a molecular weight of 270.24 g/mol. Its IUPAC name is methyl 2-(2-hydroxyacetyl)oxy-4,5-dimethoxybenzoate.
| Compound Name | methyl 2-(2-hydroxyacetyl)oxy-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 130260315 |
| Molecular Formula | C12H14O7 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | methyl 2-(2-hydroxyacetyl)oxy-4,5-dimethoxybenzoate |
| SMILES | COC(=O)c1cc(OC)c(OC)cc1OC(=O)CO |
| InChI | InChI=1S/C12H14O7/c1-16-9-4-7(12(15)18-3)8(5-10(9)17-2)19-11(14)6-13/h4-5,13H,6H2,1-3H3 |
| InChIKey | PPSZQVOCVAVLDO-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|