C11H14Br2ClNO — CID 171217191
2-[(1S)-1-aminopent-4-enyl]-4,6-dibromophenol;hydrochloride (PubChem CID 171217191) has the molecular formula C11H14Br2ClNO and a molecular weight of 371.50 g/mol. Its IUPAC name is 2-[(1S)-1-aminopent-4-enyl]-4,6-dibromophenol;hydrochloride.
| Compound Name | 2-[(1S)-1-aminopent-4-enyl]-4,6-dibromophenol;hydrochloride |
|---|---|
| PubChem CID | 171217191 |
| Molecular Formula | C11H14Br2ClNO |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 368.91 |
| IUPAC Name | 2-[(1S)-1-aminopent-4-enyl]-4,6-dibromophenol;hydrochloride |
| SMILES | C=CCC[C@H](N)c1cc(Br)cc(Br)c1O.Cl |
| InChI | InChI=1S/C11H13Br2NO.ClH/c1-2-3-4-10(14)8-5-7(12)6-9(13)11(8)15;/h2,5-6,10,15H,1,3-4,14H2;1H/t10-;/m0./s1 |
| InChIKey | QATNIAFNLYHADI-PPHPATTJSA-N |
| XLogP | 4.30 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|