C11H13BrClF2NO — CID 171257867
2-[(1R)-1-aminopent-4-enyl]-6-bromo-3,4-difluorophenol;hydrochloride (PubChem CID 171257867) has the molecular formula C11H13BrClF2NO and a molecular weight of 328.58 g/mol. Its IUPAC name is 2-[(1R)-1-aminopent-4-enyl]-6-bromo-3,4-difluorophenol;hydrochloride.
| Compound Name | 2-[(1R)-1-aminopent-4-enyl]-6-bromo-3,4-difluorophenol;hydrochloride |
|---|---|
| PubChem CID | 171257867 |
| Molecular Formula | C11H13BrClF2NO |
| Molecular Weight | 328.58 g/mol |
| Exact Mass | 326.98 |
| IUPAC Name | 2-[(1R)-1-aminopent-4-enyl]-6-bromo-3,4-difluorophenol;hydrochloride |
| SMILES | C=CCC[C@@H](N)c1c(O)c(Br)cc(F)c1F.Cl |
| InChI | InChI=1S/C11H12BrF2NO.ClH/c1-2-3-4-8(15)9-10(14)7(13)5-6(12)11(9)16;/h2,5,8,16H,1,3-4,15H2;1H/t8-;/m1./s1 |
| InChIKey | BYAZYHDTEZSABX-DDWIOCJRSA-N |
| XLogP | 3.82 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.58 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|