C15H20BNO2 — CID 101455172
(3S)-3-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanenitrile (PubChem CID 101455172) has the molecular formula C15H20BNO2 and a molecular weight of 257.14 g/mol. Its IUPAC name is (3S)-3-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanenitrile.
| Compound Name | (3S)-3-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanenitrile |
|---|---|
| PubChem CID | 101455172 |
| Molecular Formula | C15H20BNO2 |
| Molecular Weight | 257.14 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | (3S)-3-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanenitrile |
| SMILES | CC1(C)OB([C@@H](CC#N)c2ccccc2)OC1(C)C |
| InChI | InChI=1S/C15H20BNO2/c1-14(2)15(3,4)19-16(18-14)13(10-11-17)12-8-6-5-7-9-12/h5-9,13H,10H2,1-4H3/t13-/m0/s1 |
| InChIKey | BBWKWZHNONSMMB-ZDUSSCGKSA-N |
| XLogP | 3.32 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.14 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|