C14H19BN2O2 — CID 171191335
3-[(S)-amino-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]benzonitrile (PubChem CID 171191335) has the molecular formula C14H19BN2O2 and a molecular weight of 258.13 g/mol. Its IUPAC name is 3-[(S)-amino-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]benzonitrile.
| Compound Name | 3-[(S)-amino-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 171191335 |
| Molecular Formula | C14H19BN2O2 |
| Molecular Weight | 258.13 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 3-[(S)-amino-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]benzonitrile |
| SMILES | CC1(C)OB([C@H](N)c2cccc(C#N)c2)OC1(C)C |
| InChI | InChI=1S/C14H19BN2O2/c1-13(2)14(3,4)19-15(18-13)12(17)11-7-5-6-10(8-11)9-16/h5-8,12H,17H2,1-4H3/t12-/m1/s1 |
| InChIKey | SRIAPKAZBKFBHU-GFCCVEGCSA-N |
| XLogP | 2.19 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.13 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|