C21H24BClO3 — CID 71568130
(3R)-3-(3-chlorophenyl)-1-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propan-1-one (PubChem CID 71568130) has the molecular formula C21H24BClO3 and a molecular weight of 370.69 g/mol. Its IUPAC name is (3R)-3-(3-chlorophenyl)-1-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propan-1-one.
| Compound Name | (3R)-3-(3-chlorophenyl)-1-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propan-1-one |
|---|---|
| PubChem CID | 71568130 |
| Molecular Formula | C21H24BClO3 |
| Molecular Weight | 370.69 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | (3R)-3-(3-chlorophenyl)-1-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propan-1-one |
| SMILES | CC1(C)OB([C@H](CC(=O)c2ccccc2)c2cccc(Cl)c2)OC1(C)C |
| InChI | InChI=1S/C21H24BClO3/c1-20(2)21(3,4)26-22(25-20)18(16-11-8-12-17(23)13-16)14-19(24)15-9-6-5-7-10-15/h5-13,18H,14H2,1-4H3/t18-/m1/s1 |
| InChIKey | SKAYFIXBWAXWRC-GOSISDBHSA-N |
| XLogP | 5.33 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.69 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|