C17H21BBrNO4 — CID 170816022
3-(6-bromo-1H-indol-3-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid (PubChem CID 170816022) has the molecular formula C17H21BBrNO4 and a molecular weight of 394.07 g/mol. Its IUPAC name is 3-(6-bromo-1H-indol-3-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid.
| Compound Name | 3-(6-bromo-1H-indol-3-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid |
|---|---|
| PubChem CID | 170816022 |
| Molecular Formula | C17H21BBrNO4 |
| Molecular Weight | 394.07 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | 3-(6-bromo-1H-indol-3-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid |
| SMILES | CC1(C)OB(C(CC(=O)O)c2c[nH]c3cc(Br)ccc23)OC1(C)C |
| InChI | InChI=1S/C17H21BBrNO4/c1-16(2)17(3,4)24-18(23-16)13(8-15(21)22)12-9-20-14-7-10(19)5-6-11(12)14/h5-7,9,13,20H,8H2,1-4H3,(H,21,22) |
| InChIKey | VWCKPJIFKRFOOS-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.07 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|