C39H32O4 — CID 174977121
4-[1,2,2-tris(4-hydroxyphenyl)-3,3-diphenylpropyl]phenol (PubChem CID 174977121) has the molecular formula C39H32O4 and a molecular weight of 564.68 g/mol. Its IUPAC name is 4-[1,2,2-tris(4-hydroxyphenyl)-3,3-diphenylpropyl]phenol.
| Compound Name | 4-[1,2,2-tris(4-hydroxyphenyl)-3,3-diphenylpropyl]phenol |
|---|---|
| PubChem CID | 174977121 |
| Molecular Formula | C39H32O4 |
| Molecular Weight | 564.68 g/mol |
| Exact Mass | 564.23 |
| IUPAC Name | 4-[1,2,2-tris(4-hydroxyphenyl)-3,3-diphenylpropyl]phenol |
| SMILES | Oc1ccc(C(c2ccc(O)cc2)C(c2ccc(O)cc2)(c2ccc(O)cc2)C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C39H32O4/c40-33-19-11-29(12-20-33)38(30-13-21-34(41)22-14-30)39(31-15-23-35(42)24-16-31,32-17-25-36(43)26-18-32)37(27-7-3-1-4-8-27)28-9-5-2-6-10-28/h1-26,37-38,40-43H |
| InChIKey | RRPKKUFPAZDZGP-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.68 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |