About phenol;phenylmethanediol
phenol;phenylmethanediol (PubChem CID 174902406) has the molecular formula C13H14O3
and a molecular weight of 218.25 g/mol. Its IUPAC name is phenol;phenylmethanediol.
Molecular Properties
| Compound Name | phenol;phenylmethanediol |
| PubChem CID | 174902406 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | phenol;phenylmethanediol |
| SMILES | OC(O)c1ccccc1.Oc1ccccc1 |
| InChI | InChI=1S/C7H8O2.C6H6O/c8-7(9)6-4-2-1-3-5-6;7-6-4-2-1-3-5-6/h1-5,7-9H;1-5,7H |
| InChIKey | FOZMOHUXNHAGLH-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze phenol;phenylmethanediol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenol;phenylmethanediol?
The IUPAC name of phenol;phenylmethanediol (CID 174902406) is phenol;phenylmethanediol.
What is the SMILES notation for phenol;phenylmethanediol?
The canonical SMILES for phenol;phenylmethanediol is OC(O)c1ccccc1.Oc1ccccc1.
What is the InChIKey of phenol;phenylmethanediol?
The InChIKey is FOZMOHUXNHAGLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2.C6H6O/c8-7(9)6-4-2-1-3-5-6;7-6-4-2-1-3-5-6/h1-5,7-9H;1-5,7H.
What are the key properties of phenol;phenylmethanediol?
phenol;phenylmethanediol has a molecular weight of 218.25 g/mol, XLogP of 2.06, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenol;phenylmethanediol is sourced from PubChem (CID 174902406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).