About phenylmethanediol;titanium;bis(titanium(3+));dihydrate
phenylmethanediol;titanium;bis(titanium(3+));dihydrate (PubChem CID 139244939) has the molecular formula C7H12O4Ti3+6
and a molecular weight of 303.77 g/mol. Its IUPAC name is phenylmethanediol;titanium;bis(titanium(3+));dihydrate.
Molecular Properties
| Compound Name | phenylmethanediol;titanium;bis(titanium(3+));dihydrate |
| PubChem CID | 139244939 |
| Molecular Formula | C7H12O4Ti3+6 |
| Molecular Weight | 303.77 g/mol |
| Exact Mass | 303.91 |
| IUPAC Name | phenylmethanediol;titanium;bis(titanium(3+));dihydrate |
| SMILES | O.O.OC(O)c1ccccc1.[Ti+3].[Ti+3].[Ti] |
| InChI | InChI=1S/C7H8O2.2H2O.3Ti/c8-7(9)6-4-2-1-3-5-6;;;;;/h1-5,7-9H;2*1H2;;;/q;;;;2*+3 |
| InChIKey | SZVRCMRSVRJPJT-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 103.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.77 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze phenylmethanediol;titanium;bis(titanium(3+));dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenylmethanediol;titanium;bis(titanium(3+));dihydrate?
The IUPAC name of phenylmethanediol;titanium;bis(titanium(3+));dihydrate (CID 139244939) is phenylmethanediol;titanium;bis(titanium(3+));dihydrate.
What is the SMILES notation for phenylmethanediol;titanium;bis(titanium(3+));dihydrate?
The canonical SMILES for phenylmethanediol;titanium;bis(titanium(3+));dihydrate is O.O.OC(O)c1ccccc1.[Ti+3].[Ti+3].[Ti].
What is the InChIKey of phenylmethanediol;titanium;bis(titanium(3+));dihydrate?
The InChIKey is SZVRCMRSVRJPJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2.2H2O.3Ti/c8-7(9)6-4-2-1-3-5-6;;;;;/h1-5,7-9H;2*1H2;;;/q;;;;2*+3.
What are the key properties of phenylmethanediol;titanium;bis(titanium(3+));dihydrate?
phenylmethanediol;titanium;bis(titanium(3+));dihydrate has a molecular weight of 303.77 g/mol, XLogP of -0.99, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenylmethanediol;titanium;bis(titanium(3+));dihydrate is sourced from PubChem (CID 139244939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).