C23H23NO3 — CID 154721057
(2S,3S)-2-(aminomethyl)-2-benzyl-3-(4-hydroxyphenyl)-3-phenylpropanoic acid (PubChem CID 154721057) has the molecular formula C23H23NO3 and a molecular weight of 361.44 g/mol. Its IUPAC name is (2S,3S)-2-(aminomethyl)-2-benzyl-3-(4-hydroxyphenyl)-3-phenylpropanoic acid.
| Compound Name | (2S,3S)-2-(aminomethyl)-2-benzyl-3-(4-hydroxyphenyl)-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 154721057 |
| Molecular Formula | C23H23NO3 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | (2S,3S)-2-(aminomethyl)-2-benzyl-3-(4-hydroxyphenyl)-3-phenylpropanoic acid |
| SMILES | NC[C@@](Cc1ccccc1)(C(=O)O)[C@@H](c1ccccc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C23H23NO3/c24-16-23(22(26)27,15-17-7-3-1-4-8-17)21(18-9-5-2-6-10-18)19-11-13-20(25)14-12-19/h1-14,21,25H,15-16,24H2,(H,26,27)/t21-,23+/m0/s1 |
| InChIKey | YEFICHBPCKXXOR-JTHBVZDNSA-N |
| XLogP | 3.80 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |