C22H24NOP — CID 101267693
(1S)-N-diphenylphosphoryl-1-(2-methylphenyl)propan-1-amine (PubChem CID 101267693) has the molecular formula C22H24NOP and a molecular weight of 349.41 g/mol. Its IUPAC name is (1S)-N-diphenylphosphoryl-1-(2-methylphenyl)propan-1-amine.
| Compound Name | (1S)-N-diphenylphosphoryl-1-(2-methylphenyl)propan-1-amine |
|---|---|
| PubChem CID | 101267693 |
| Molecular Formula | C22H24NOP |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | (1S)-N-diphenylphosphoryl-1-(2-methylphenyl)propan-1-amine |
| SMILES | CC[C@H](NP(=O)(c1ccccc1)c1ccccc1)c1ccccc1C |
| InChI | InChI=1S/C22H24NOP/c1-3-22(21-17-11-10-12-18(21)2)23-25(24,19-13-6-4-7-14-19)20-15-8-5-9-16-20/h4-17,22H,3H2,1-2H3,(H,23,24)/t22-/m0/s1 |
| InChIKey | FKZBFQUQKMPDEE-QFIPXVFZSA-N |
| XLogP | 4.96 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|