C19H26NOP — CID 132535903
(2S)-4-methyl-N-[(2-methylphenyl)-phenylphosphoryl]pentan-2-amine (PubChem CID 132535903) has the molecular formula C19H26NOP and a molecular weight of 315.40 g/mol. Its IUPAC name is (2S)-4-methyl-N-[(2-methylphenyl)-phenylphosphoryl]pentan-2-amine.
| Compound Name | (2S)-4-methyl-N-[(2-methylphenyl)-phenylphosphoryl]pentan-2-amine |
|---|---|
| PubChem CID | 132535903 |
| Molecular Formula | C19H26NOP |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | (2S)-4-methyl-N-[(2-methylphenyl)-phenylphosphoryl]pentan-2-amine |
| SMILES | Cc1ccccc1P(=O)(N[C@@H](C)CC(C)C)c1ccccc1 |
| InChI | InChI=1S/C19H26NOP/c1-15(2)14-17(4)20-22(21,18-11-6-5-7-12-18)19-13-9-8-10-16(19)3/h5-13,15,17H,14H2,1-4H3,(H,20,21)/t17-,22?/m0/s1 |
| InChIKey | PARVNGUDBPVEFA-LBOXEOMUSA-N |
| XLogP | 4.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|