C13H21N2O3P — CID 129387880
(2S)-N-hydroxy-4-methyl-2-[[methyl(phenyl)phosphoryl]amino]pentanamide (PubChem CID 129387880) has the molecular formula C13H21N2O3P and a molecular weight of 284.30 g/mol. Its IUPAC name is (2S)-N-hydroxy-4-methyl-2-[[methyl(phenyl)phosphoryl]amino]pentanamide.
| Compound Name | (2S)-N-hydroxy-4-methyl-2-[[methyl(phenyl)phosphoryl]amino]pentanamide |
|---|---|
| PubChem CID | 129387880 |
| Molecular Formula | C13H21N2O3P |
| Molecular Weight | 284.30 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | (2S)-N-hydroxy-4-methyl-2-[[methyl(phenyl)phosphoryl]amino]pentanamide |
| SMILES | CC(C)C[C@H](N[P@](C)(=O)c1ccccc1)C(=O)NO |
| InChI | InChI=1S/C13H21N2O3P/c1-10(2)9-12(13(16)14-17)15-19(3,18)11-7-5-4-6-8-11/h4-8,10,12,17H,9H2,1-3H3,(H,14,16)(H,15,18)/t12-,19+/m0/s1 |
| InChIKey | VERLVIKCRNRVAE-HXPMCKFVSA-N |
| XLogP | 1.73 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.30 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|