C13H20NO4P — CID 15939366
(2R)-2-[[hydroxy(phenyl)phosphoryl]methylamino]-4-methylpentanoic acid (PubChem CID 15939366) has the molecular formula C13H20NO4P and a molecular weight of 285.28 g/mol. Its IUPAC name is (2R)-2-[[hydroxy(phenyl)phosphoryl]methylamino]-4-methylpentanoic acid.
| Compound Name | (2R)-2-[[hydroxy(phenyl)phosphoryl]methylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 15939366 |
| Molecular Formula | C13H20NO4P |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | (2R)-2-[[hydroxy(phenyl)phosphoryl]methylamino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@@H](NCP(=O)(O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C13H20NO4P/c1-10(2)8-12(13(15)16)14-9-19(17,18)11-6-4-3-5-7-11/h3-7,10,12,14H,8-9H2,1-2H3,(H,15,16)(H,17,18)/t12-/m1/s1 |
| InChIKey | MWTSCMOHRFMFIA-GFCCVEGCSA-N |
| XLogP | 1.63 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|