C20H26N2O2 — CID 72736743
(2S)-2-(2,2-dibenzylhydrazinyl)-4-methylpentanoic acid (PubChem CID 72736743) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is (2S)-2-(2,2-dibenzylhydrazinyl)-4-methylpentanoic acid.
| Compound Name | (2S)-2-(2,2-dibenzylhydrazinyl)-4-methylpentanoic acid |
|---|---|
| PubChem CID | 72736743 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | (2S)-2-(2,2-dibenzylhydrazinyl)-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NN(Cc1ccccc1)Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C20H26N2O2/c1-16(2)13-19(20(23)24)21-22(14-17-9-5-3-6-10-17)15-18-11-7-4-8-12-18/h3-12,16,19,21H,13-15H2,1-2H3,(H,23,24)/t19-/m0/s1 |
| InChIKey | GEYSIZHSZDVMIU-IBGZPJMESA-N |
| XLogP | 3.69 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|