C12H17N3O4 — CID 155092384
(2S)-4-methyl-2-(2-nitro-2-phenylhydrazinyl)pentanoic acid (PubChem CID 155092384) has the molecular formula C12H17N3O4 and a molecular weight of 267.29 g/mol. Its IUPAC name is (2S)-4-methyl-2-(2-nitro-2-phenylhydrazinyl)pentanoic acid.
| Compound Name | (2S)-4-methyl-2-(2-nitro-2-phenylhydrazinyl)pentanoic acid |
|---|---|
| PubChem CID | 155092384 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | (2S)-4-methyl-2-(2-nitro-2-phenylhydrazinyl)pentanoic acid |
| SMILES | CC(C)C[C@H](NN(c1ccccc1)[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C12H17N3O4/c1-9(2)8-11(12(16)17)13-14(15(18)19)10-6-4-3-5-7-10/h3-7,9,11,13H,8H2,1-2H3,(H,16,17)/t11-/m0/s1 |
| InChIKey | PNODNVGZFGHJCC-NSHDSACASA-N |
| XLogP | 1.69 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|