C15H23NO4 — CID 142163724
(2S)-2-[[(2S)-1,1-dihydroxy-3-phenylpropan-2-yl]amino]-4-methylpentanoic acid (PubChem CID 142163724) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is (2S)-2-[[(2S)-1,1-dihydroxy-3-phenylpropan-2-yl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[(2S)-1,1-dihydroxy-3-phenylpropan-2-yl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 142163724 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | (2S)-2-[[(2S)-1,1-dihydroxy-3-phenylpropan-2-yl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](N[C@@H](Cc1ccccc1)C(O)O)C(=O)O |
| InChI | InChI=1S/C15H23NO4/c1-10(2)8-12(14(17)18)16-13(15(19)20)9-11-6-4-3-5-7-11/h3-7,10,12-13,15-16,19-20H,8-9H2,1-2H3,(H,17,18)/t12-,13-/m0/s1 |
| InChIKey | OTPDJFUMSUOUJY-STQMWFEESA-N |
| XLogP | 1.00 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|