C23H30N2O6 — CID 142141665
(2S)-2-[[(2S)-1,1-dihydroxy-3-[4-[(2-methoxybenzoyl)amino]phenyl]propan-2-yl]amino]-4-methylpentanoic acid (PubChem CID 142141665) has the molecular formula C23H30N2O6 and a molecular weight of 430.50 g/mol. Its IUPAC name is (2S)-2-[[(2S)-1,1-dihydroxy-3-[4-[(2-methoxybenzoyl)amino]phenyl]propan-2-yl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[(2S)-1,1-dihydroxy-3-[4-[(2-methoxybenzoyl)amino]phenyl]propan-2-yl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 142141665 |
| Molecular Formula | C23H30N2O6 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | (2S)-2-[[(2S)-1,1-dihydroxy-3-[4-[(2-methoxybenzoyl)amino]phenyl]propan-2-yl]amino]-4-methylpentanoic acid |
| SMILES | COc1ccccc1C(=O)Nc1ccc(C[C@H](N[C@@H](CC(C)C)C(=O)O)C(O)O)cc1 |
| InChI | InChI=1S/C23H30N2O6/c1-14(2)12-18(22(27)28)25-19(23(29)30)13-15-8-10-16(11-9-15)24-21(26)17-6-4-5-7-20(17)31-3/h4-11,14,18-19,23,25,29-30H,12-13H2,1-3H3,(H,24,26)(H,27,28)/t18-,19-/m0/s1 |
| InChIKey | QRTBCRMNARXPRG-OALUTQOASA-N |
| XLogP | 2.26 |
| TPSA | 128.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|