C21H26N2O3 — CID 163211996
(2R)-2-(2,2-diphenylpropanoylamino)-N-hydroxy-4-methylpentanamide (PubChem CID 163211996) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is (2R)-2-(2,2-diphenylpropanoylamino)-N-hydroxy-4-methylpentanamide.
| Compound Name | (2R)-2-(2,2-diphenylpropanoylamino)-N-hydroxy-4-methylpentanamide |
|---|---|
| PubChem CID | 163211996 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | (2R)-2-(2,2-diphenylpropanoylamino)-N-hydroxy-4-methylpentanamide |
| SMILES | CC(C)C[C@@H](NC(=O)C(C)(c1ccccc1)c1ccccc1)C(=O)NO |
| InChI | InChI=1S/C21H26N2O3/c1-15(2)14-18(19(24)23-26)22-20(25)21(3,16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-13,15,18,26H,14H2,1-3H3,(H,22,25)(H,23,24)/t18-/m1/s1 |
| InChIKey | KJASJBJHZIJJMK-GOSISDBHSA-N |
| XLogP | 3.03 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|