C16H23NO3 — CID 120606642
3-(2-ethylbutanoylamino)-3-(2-methylphenyl)propanoic acid (PubChem CID 120606642) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is 3-(2-ethylbutanoylamino)-3-(2-methylphenyl)propanoic acid.
| Compound Name | 3-(2-ethylbutanoylamino)-3-(2-methylphenyl)propanoic acid |
|---|---|
| PubChem CID | 120606642 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 3-(2-ethylbutanoylamino)-3-(2-methylphenyl)propanoic acid |
| SMILES | CCC(CC)C(=O)NC(CC(=O)O)c1ccccc1C |
| InChI | InChI=1S/C16H23NO3/c1-4-12(5-2)16(20)17-14(10-15(18)19)13-9-7-6-8-11(13)3/h6-9,12,14H,4-5,10H2,1-3H3,(H,17,20)(H,18,19) |
| InChIKey | AZHIHCYRRMBVDO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |