C35H33O3P — CID 10896754
(1S,2S,4S)-2-diphenylphosphoryl-1,4-diphenyl-4-phenylmethoxybutan-1-ol (PubChem CID 10896754) has the molecular formula C35H33O3P and a molecular weight of 532.62 g/mol. Its IUPAC name is (1S,2S,4S)-2-diphenylphosphoryl-1,4-diphenyl-4-phenylmethoxybutan-1-ol.
| Compound Name | (1S,2S,4S)-2-diphenylphosphoryl-1,4-diphenyl-4-phenylmethoxybutan-1-ol |
|---|---|
| PubChem CID | 10896754 |
| Molecular Formula | C35H33O3P |
| Molecular Weight | 532.62 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | (1S,2S,4S)-2-diphenylphosphoryl-1,4-diphenyl-4-phenylmethoxybutan-1-ol |
| SMILES | O=P(c1ccccc1)(c1ccccc1)[C@@H](C[C@H](OCc1ccccc1)c1ccccc1)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C35H33O3P/c36-35(30-20-10-3-11-21-30)34(39(37,31-22-12-4-13-23-31)32-24-14-5-15-25-32)26-33(29-18-8-2-9-19-29)38-27-28-16-6-1-7-17-28/h1-25,33-36H,26-27H2/t33-,34-,35-/m0/s1 |
| InChIKey | XBECFALVKIICLT-IMKBVMFZSA-N |
| XLogP | 7.45 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.62 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|