C27H27O4P — CID 10647028
(1R,2S)-2-diphenylphosphoryl-1-(furan-2-yl)-4-phenylmethoxybutan-1-ol (PubChem CID 10647028) has the molecular formula C27H27O4P and a molecular weight of 446.48 g/mol. Its IUPAC name is (1R,2S)-2-diphenylphosphoryl-1-(furan-2-yl)-4-phenylmethoxybutan-1-ol.
| Compound Name | (1R,2S)-2-diphenylphosphoryl-1-(furan-2-yl)-4-phenylmethoxybutan-1-ol |
|---|---|
| PubChem CID | 10647028 |
| Molecular Formula | C27H27O4P |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | (1R,2S)-2-diphenylphosphoryl-1-(furan-2-yl)-4-phenylmethoxybutan-1-ol |
| SMILES | O=P(c1ccccc1)(c1ccccc1)[C@@H](CCOCc1ccccc1)[C@H](O)c1ccco1 |
| InChI | InChI=1S/C27H27O4P/c28-27(25-17-10-19-31-25)26(18-20-30-21-22-11-4-1-5-12-22)32(29,23-13-6-2-7-14-23)24-15-8-3-9-16-24/h1-17,19,26-28H,18,20-21H2/t26-,27+/m0/s1 |
| InChIKey | OUQQTQFKMXXJAB-RRPNLBNLSA-N |
| XLogP | 5.30 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|