C29H35O3P — CID 101034914
(E,4R,5S,7R)-5-diphenylphosphoryl-3-methyl-7-phenylmethoxynon-2-en-4-ol (PubChem CID 101034914) has the molecular formula C29H35O3P and a molecular weight of 462.57 g/mol. Its IUPAC name is (E,4R,5S,7R)-5-diphenylphosphoryl-3-methyl-7-phenylmethoxynon-2-en-4-ol.
| Compound Name | (E,4R,5S,7R)-5-diphenylphosphoryl-3-methyl-7-phenylmethoxynon-2-en-4-ol |
|---|---|
| PubChem CID | 101034914 |
| Molecular Formula | C29H35O3P |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | (E,4R,5S,7R)-5-diphenylphosphoryl-3-methyl-7-phenylmethoxynon-2-en-4-ol |
| SMILES | C/C=C(\C)[C@@H](O)[C@H](C[C@@H](CC)OCc1ccccc1)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H35O3P/c1-4-23(3)29(30)28(21-25(5-2)32-22-24-15-9-6-10-16-24)33(31,26-17-11-7-12-18-26)27-19-13-8-14-20-27/h4,6-20,25,28-30H,5,21-22H2,1-3H3/b23-4+/t25-,28+,29-/m1/s1 |
| InChIKey | LPPBROGFQKZGBO-QIWHFNFOSA-N |
| XLogP | 6.08 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|