C33H43O5P — CID 101035000
(4R,5S,6R,8S)-8-cyclohexyl-6-diphenylphosphoryl-8-phenylmethoxyoctane-1,4,5-triol (PubChem CID 101035000) has the molecular formula C33H43O5P and a molecular weight of 550.68 g/mol. Its IUPAC name is (4R,5S,6R,8S)-8-cyclohexyl-6-diphenylphosphoryl-8-phenylmethoxyoctane-1,4,5-triol.
| Compound Name | (4R,5S,6R,8S)-8-cyclohexyl-6-diphenylphosphoryl-8-phenylmethoxyoctane-1,4,5-triol |
|---|---|
| PubChem CID | 101035000 |
| Molecular Formula | C33H43O5P |
| Molecular Weight | 550.68 g/mol |
| Exact Mass | 550.28 |
| IUPAC Name | (4R,5S,6R,8S)-8-cyclohexyl-6-diphenylphosphoryl-8-phenylmethoxyoctane-1,4,5-triol |
| SMILES | O=P(c1ccccc1)(c1ccccc1)[C@H](C[C@H](OCc1ccccc1)C1CCCCC1)[C@@H](O)[C@H](O)CCCO |
| InChI | InChI=1S/C33H43O5P/c34-23-13-22-30(35)33(36)32(39(37,28-18-9-3-10-19-28)29-20-11-4-12-21-29)24-31(27-16-7-2-8-17-27)38-25-26-14-5-1-6-15-26/h1,3-6,9-12,14-15,18-21,27,30-36H,2,7-8,13,16-17,22-25H2/t30-,31+,32-,33+/m1/s1 |
| InChIKey | JBVBVYGEXQUUHY-LVVLYVGBSA-N |
| XLogP | 5.42 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.68 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|