C24H41O3PSi — CID 166637256
[(3R)-3-diethoxyphosphoryl-5-phenylpent-1-ynyl]-tri(propan-2-yl)silane (PubChem CID 166637256) has the molecular formula C24H41O3PSi and a molecular weight of 436.65 g/mol. Its IUPAC name is [(3R)-3-diethoxyphosphoryl-5-phenylpent-1-ynyl]-tri(propan-2-yl)silane.
| Compound Name | [(3R)-3-diethoxyphosphoryl-5-phenylpent-1-ynyl]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 166637256 |
| Molecular Formula | C24H41O3PSi |
| Molecular Weight | 436.65 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | [(3R)-3-diethoxyphosphoryl-5-phenylpent-1-ynyl]-tri(propan-2-yl)silane |
| SMILES | CCOP(=O)(OCC)[C@@H](C#C[Si](C(C)C)(C(C)C)C(C)C)CCc1ccccc1 |
| InChI | InChI=1S/C24H41O3PSi/c1-9-26-28(25,27-10-2)24(17-16-23-14-12-11-13-15-23)18-19-29(20(3)4,21(5)6)22(7)8/h11-15,20-22,24H,9-10,16-17H2,1-8H3/t24-/m1/s1 |
| InChIKey | XILMUMBQXKWECB-XMMPIXPASA-N |
| XLogP | 7.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.65 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|