C34H45O3PSi — CID 166637260
[(3R)-3-bis(phenylmethoxy)phosphoryl-5-phenylpent-1-ynyl]-tri(propan-2-yl)silane (PubChem CID 166637260) has the molecular formula C34H45O3PSi and a molecular weight of 560.79 g/mol. Its IUPAC name is [(3R)-3-bis(phenylmethoxy)phosphoryl-5-phenylpent-1-ynyl]-tri(propan-2-yl)silane.
| Compound Name | [(3R)-3-bis(phenylmethoxy)phosphoryl-5-phenylpent-1-ynyl]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 166637260 |
| Molecular Formula | C34H45O3PSi |
| Molecular Weight | 560.79 g/mol |
| Exact Mass | 560.29 |
| IUPAC Name | [(3R)-3-bis(phenylmethoxy)phosphoryl-5-phenylpent-1-ynyl]-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C#C[C@@H](CCc1ccccc1)P(=O)(OCc1ccccc1)OCc1ccccc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C34H45O3PSi/c1-28(2)39(29(3)4,30(5)6)25-24-34(23-22-31-16-10-7-11-17-31)38(35,36-26-32-18-12-8-13-19-32)37-27-33-20-14-9-15-21-33/h7-21,28-30,34H,22-23,26-27H2,1-6H3/t34-/m1/s1 |
| InChIKey | JAAFPVLXUKHUPZ-UUWRZZSWSA-N |
| XLogP | 9.84 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.79 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|