C26H31O8PS — CID 10744873
1-diethoxyphosphoryl-4-[3-(2-phenoxyphenoxy)phenyl]butane-1-sulfonic acid (PubChem CID 10744873) has the molecular formula C26H31O8PS and a molecular weight of 534.57 g/mol. Its IUPAC name is 1-diethoxyphosphoryl-4-[3-(2-phenoxyphenoxy)phenyl]butane-1-sulfonic acid.
| Compound Name | 1-diethoxyphosphoryl-4-[3-(2-phenoxyphenoxy)phenyl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 10744873 |
| Molecular Formula | C26H31O8PS |
| Molecular Weight | 534.57 g/mol |
| Exact Mass | 534.15 |
| IUPAC Name | 1-diethoxyphosphoryl-4-[3-(2-phenoxyphenoxy)phenyl]butane-1-sulfonic acid |
| SMILES | CCOP(=O)(OCC)C(CCCc1cccc(Oc2ccccc2Oc2ccccc2)c1)S(=O)(=O)O |
| InChI | InChI=1S/C26H31O8PS/c1-3-31-35(27,32-4-2)26(36(28,29)30)19-11-13-21-12-10-16-23(20-21)34-25-18-9-8-17-24(25)33-22-14-6-5-7-15-22/h5-10,12,14-18,20,26H,3-4,11,13,19H2,1-2H3,(H,28,29,30) |
| InChIKey | XCTQVNVFEIJTOG-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.57 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|