C16H16O8PS-3 — CID 91934190
4-[3-(4-hydroxyphenoxy)phenyl]-1-phosphonatobutane-1-sulfonate (PubChem CID 91934190) has the molecular formula C16H16O8PS-3 and a molecular weight of 399.34 g/mol. Its IUPAC name is 4-[3-(4-hydroxyphenoxy)phenyl]-1-phosphonatobutane-1-sulfonate.
| Compound Name | 4-[3-(4-hydroxyphenoxy)phenyl]-1-phosphonatobutane-1-sulfonate |
|---|---|
| PubChem CID | 91934190 |
| Molecular Formula | C16H16O8PS-3 |
| Molecular Weight | 399.34 g/mol |
| Exact Mass | 399.03 |
| IUPAC Name | 4-[3-(4-hydroxyphenoxy)phenyl]-1-phosphonatobutane-1-sulfonate |
| SMILES | O=P([O-])([O-])C(CCCc1cccc(Oc2ccc(O)cc2)c1)S(=O)(=O)[O-] |
| InChI | InChI=1S/C16H19O8PS/c17-13-7-9-14(10-8-13)24-15-5-1-3-12(11-15)4-2-6-16(25(18,19)20)26(21,22)23/h1,3,5,7-11,16-17H,2,4,6H2,(H2,18,19,20)(H,21,22,23)/p-3 |
| InChIKey | BACQEWXQGHYYEU-UHFFFAOYSA-K |
| XLogP | 1.29 |
| TPSA | 149.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.34 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|