C16H16F2KO7PS — CID 24783431
potassium 4-[2-fluoro-5-(4-fluorophenoxy)phenyl]-1-phosphonobutane-1-sulfonate (PubChem CID 24783431) has the molecular formula C16H16F2KO7PS and a molecular weight of 460.43 g/mol. Its IUPAC name is potassium 4-[2-fluoro-5-(4-fluorophenoxy)phenyl]-1-phosphonobutane-1-sulfonate.
| Compound Name | potassium 4-[2-fluoro-5-(4-fluorophenoxy)phenyl]-1-phosphonobutane-1-sulfonate |
|---|---|
| PubChem CID | 24783431 |
| Molecular Formula | C16H16F2KO7PS |
| Molecular Weight | 460.43 g/mol |
| Exact Mass | 460.00 |
| IUPAC Name | potassium 4-[2-fluoro-5-(4-fluorophenoxy)phenyl]-1-phosphonobutane-1-sulfonate |
| SMILES | O=P(O)(O)C(CCCc1cc(Oc2ccc(F)cc2)ccc1F)S(=O)(=O)[O-].[K+] |
| InChI | InChI=1S/C16H17F2O7PS.K/c17-12-4-6-13(7-5-12)25-14-8-9-15(18)11(10-14)2-1-3-16(26(19,20)21)27(22,23)24;/h4-10,16H,1-3H2,(H2,19,20,21)(H,22,23,24);/q;+1/p-1 |
| InChIKey | PKCUAYSYSRKMJX-UHFFFAOYSA-M |
| XLogP | 0.13 |
| TPSA | 123.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.43 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|