C20H25O7PS — CID 87171992
[4-[3-(4-tert-butylphenoxy)phenyl]-1-sulfobutoxy]-oxido-oxophosphanium (PubChem CID 87171992) has the molecular formula C20H25O7PS and a molecular weight of 440.45 g/mol. Its IUPAC name is [4-[3-(4-tert-butylphenoxy)phenyl]-1-sulfobutoxy]-oxido-oxophosphanium.
| Compound Name | [4-[3-(4-tert-butylphenoxy)phenyl]-1-sulfobutoxy]-oxido-oxophosphanium |
|---|---|
| PubChem CID | 87171992 |
| Molecular Formula | C20H25O7PS |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | [4-[3-(4-tert-butylphenoxy)phenyl]-1-sulfobutoxy]-oxido-oxophosphanium |
| SMILES | CC(C)(C)c1ccc(Oc2cccc(CCCC(O[P+](=O)[O-])S(=O)(=O)O)c2)cc1 |
| InChI | InChI=1S/C20H25O7PS/c1-20(2,3)16-10-12-17(13-11-16)26-18-8-4-6-15(14-18)7-5-9-19(27-28(21)22)29(23,24)25/h4,6,8,10-14,19H,5,7,9H2,1-3H3,(H,23,24,25) |
| InChIKey | SQYZXTCAIGEBLY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 112.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|