C17H19O6PS — CID 87171981
[4-[4-(4-methylphenyl)phenyl]-1-sulfobutoxy]-oxido-oxophosphanium (PubChem CID 87171981) has the molecular formula C17H19O6PS and a molecular weight of 382.37 g/mol. Its IUPAC name is [4-[4-(4-methylphenyl)phenyl]-1-sulfobutoxy]-oxido-oxophosphanium.
| Compound Name | [4-[4-(4-methylphenyl)phenyl]-1-sulfobutoxy]-oxido-oxophosphanium |
|---|---|
| PubChem CID | 87171981 |
| Molecular Formula | C17H19O6PS |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | [4-[4-(4-methylphenyl)phenyl]-1-sulfobutoxy]-oxido-oxophosphanium |
| SMILES | Cc1ccc(-c2ccc(CCCC(O[P+](=O)[O-])S(=O)(=O)O)cc2)cc1 |
| InChI | InChI=1S/C17H19O6PS/c1-13-5-9-15(10-6-13)16-11-7-14(8-12-16)3-2-4-17(23-24(18)19)25(20,21)22/h5-12,17H,2-4H2,1H3,(H,20,21,22) |
| InChIKey | PNFGPIWFIWYUQH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|