C40H50O11PS2+ — CID 87689419
bis[4-[3-(4-tert-butylphenoxy)phenyl]-1-sulfobutoxy]-oxophosphanium (PubChem CID 87689419) has the molecular formula C40H50O11PS2+ and a molecular weight of 801.94 g/mol. Its IUPAC name is bis[4-[3-(4-tert-butylphenoxy)phenyl]-1-sulfobutoxy]-oxophosphanium.
| Compound Name | bis[4-[3-(4-tert-butylphenoxy)phenyl]-1-sulfobutoxy]-oxophosphanium |
|---|---|
| PubChem CID | 87689419 |
| Molecular Formula | C40H50O11PS2+ |
| Molecular Weight | 801.94 g/mol |
| Exact Mass | 801.25 |
| IUPAC Name | bis[4-[3-(4-tert-butylphenoxy)phenyl]-1-sulfobutoxy]-oxophosphanium |
| SMILES | CC(C)(C)c1ccc(Oc2cccc(CCCC(O[P+](=O)OC(CCCc3cccc(Oc4ccc(C(C)(C)C)cc4)c3)S(=O)(=O)O)S(=O)(=O)O)c2)cc1 |
| InChI | InChI=1S/C40H49O11PS2/c1-39(2,3)31-19-23-33(24-20-31)48-35-15-7-11-29(27-35)13-9-17-37(53(42,43)44)50-52(41)51-38(54(45,46)47)18-10-14-30-12-8-16-36(28-30)49-34-25-21-32(22-26-34)40(4,5)6/h7-8,11-12,15-16,19-28,37-38H,9-10,13-14,17-18H2,1-6H3,(H-,42,43,44,45,46,47)/p+1 |
| InChIKey | LWURGTJKVRSGNS-UHFFFAOYSA-O |
| XLogP | 10.33 |
| TPSA | 162.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.94 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|